4-Formyl-1-methylpyridinium benzenesulfonate
4-Formyl-1-methylpyridinium benzenesulfonate is a pyridinium salt widely used for the conversion of primary amines to the carbonyl compounds like aldehydes and ketones. The reaction conditions are mild, suitable for compounds with sensitive functional groups thereby providing an efficient alternative for such transformations.
Catalog Number | CBB1118771 |
Molecular Formula | C13H13NO4S |
CAS# | 82228-89-5 |
Purity | >95% |
Inchi | 1S/C7H8NO.C6H6O3S/c1-8-4-2-7(6-9)3-5-8;7-10(8,9)6-4-2-1-3-5-6/h2-6H,1H3;1-5H,(H,7,8,9)/q+1;/p-1 |
Inchi Key | HSVLGIFAXFDLMU-UHFFFAOYSA-M |
SMILES | [H]C(=O)c1cc[n+](C)cc1.[O-]S(=O)(=O)c2ccccc2 |
Size | Inquiry |
Supplier Page | https://www.amerigoscientific.com/4-formyl-1-methylpyridinium-benzenesulfonate-item-118771.html |