Lumefantrine
Lumefantrine is an antimalarial drug only used in combination with Artemether to treat acute uncomplicated malaria. Lumefantrine also blocks the rapidly activating delayed-rectifier potassium channel (IKr; IC50 = 8.1 µM).
| Trivial name | Benflumetol |
| Catalog Number | CSN10394 |
| Alternative Name(s) | Benflumetol |
| Research Area | Infection |
| Molecular Formula | C30H32Cl3NO |
| CAS# | 82186-77-4 |
| Purity | ≥99% |
| SMILES | ClC1=CC=C(C=C1)/C=C2C3=C(C4=C\2C=C(Cl)C=C4)C(C(O)CN(CCCC)CCCC)=CC(Cl)=C3 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/lumefantrine.html |
