FMK 25mg
FMK is potent, highly specific and irreversible inhibitor of p90 ribosomal protein S6 kinase RSK1 and RSK2; Fmk binds in the CTKD ATP-binding site and inhibits RSK autophosphorylation at Ser386. Fmk induces significant apoptosis in human FGFR3-expressing, t(4;14)-positive multiple myeloma cells.
| Trivial name | FMK 25mg |
| Catalog Number | A11423-25 |
| Alternative Name(s) | 1-[4-Amino-7-(3-hydroxypropyl)-5-(4-methylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-2-fluoroethanone |
| Molecular Formula | C18H19FN4O2 |
| CAS# | 821794-92-7 |
| SMILES | CC1=CC=C(C=C1)C2=C(N(C3=C2C(=NC=N3)N)CCCO)C(=O)CF |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/fmk.html |
