NSC 33994 100mg
NSC 33994 is novel inhibitor of JAK2 tyrosine kinase (Janus kinase 2 ). Janus kinase 2 (JAK2) plays a crucial role in the pathomechanism of myeloproliferative disorders and hematological malignancies.
| Trivial name | NSC 33994 100mg |
| Catalog Number | A15389-100 |
| Alternative Name(s) | 2-(diethylaminomethyl)-4-[(E)-4-[3-(diethylaminomethyl)-4-hydroxyphenyl]hex-3-en-3-yl]phenol |
| Molecular Formula | C28H42N2O2 |
| CAS# | 82058-16-0 |
| SMILES | CCC(=C(CC)C1=CC(=C(C=C1)O)CN(CC)CC)C2=CC(=C(C=C2)O)CN(CC)CC |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/nsc-33994.html |
