Cilastatin
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-10873 |
| Alternative Name(s) | (2Z)-7-[[(2R)-2-amino-2-carboxyethyl]thio]-2-[[[(1S)-2,2-dimethylcyclopropyl]carbonyl]amino]-2-heptenoic Acid;CS-O-10349; CS-O-31981 |
| Research Area | Prevents renal metabolism of penem and carbapenem antibiotics by specific and reversible dehydropeptidase I inhibition. Antibacterial adjunct. |
| Molecular Formula | C16H26N2O5S |
| CAS# | 82009-34-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C([C@@H]1C(C)(C)C1)N/C(C(O)=O)=CCCCCSC[C@H](N)C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10873.html |
| Additional Information | NULL |