3-Demethyl Thiocolchicine-Beta-O-Beta-D-Glucuronide
Glucuronides
| Trivial name | NULL |
| Catalog Number | CS-T-51876 |
| Alternative Name(s) | (2R,3R,4R,5S,6R)-6-{[(10S)-1lsulfanyl)-13- oxo]hexadeca-1(16),2,4,6,11,14- hexaen-5-yl]oxy}-3,4,5-trihydroxyoxane-2- carboxylic acid; |
| Research Area | The major metabolite of Thiocolchicoside (TCC), a muscle relaxant drug. |
| Molecular Formula | C27H31NO11S |
| CAS# | 819802-34-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | COC(C(OC)=C(O[C@@H]([C@@H]([C@@H](O)[C@@H]1O)O)O[C@@H]1C(O)=O)C=C2CC[C@H](NC(C)=O)C3=C4)=C2C3=CC=C(SC)C4=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST51876.html |
| Additional Information | NULL |