1-Pyrenebutanoyl-CoA | MedChemExpress (MCE)
1-Pyrenebutanoyl-CoA is a type of coenzyme A that can non-competitively inhibit (Ki = 2 pM) phosphorylating (ADP-stimulated) respiration in rat liver mitochondria, and competitively inhibit (Ki = 2.1 pM and 15 pM) carnitine palmitoyl-CoA transferase and octanoyl-CoA transferase[1].
| Trivial name | 1-Pyrenebutanoyl-CoA |
| Catalog Number | HY-E70252 |
| Research Area | Cardiovascular Disease |
| CAS# | 81923-89-9 |
| Purity | ≥98.0% |
| SMILES | O[C@@H]1[C@H](OP(O)(O)=O)[C@@H](COP(O)(OP(O)(OCC(C)([C@H](C(NCCC(NCCSC(CCCC2=C3C4=C5C(C=C3)=CC=CC5=CC=C4C=C2)=O)=O)=O)O)C)=O)=O)O[C@H]1N6C7=NC=NC(N)=C7N=C6 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/1-pyrenebutanoyl-coa.html |