Bambuterol HCl
Bambuterol HCl, a prodrug of terbutaline, is a long-acting β adrenoceptor agonist used in the treatment of asthma with elimination half-life of 13 hours.
| Trivial name | KWD-2183; (±)-Bambuterol HCl |
| Catalog Number | CSN12452 |
| Alternative Name(s) | KWD-2183; (±)-Bambuterol HCl |
| Research Area | / |
| Molecular Formula | C18H30ClN3O5 |
| CAS# | 81732-46-9 |
| Purity | ≥99% |
| SMILES | O=C(OC1=CC(C(O)CNC(C)(C)C)=CC(OC(N(C)C)=O)=C1)N(C)C.[H]Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/bambuterol-hcl.html |