NSC348884 50mg
NSC348884 is a nucleolar phosphoprotein that displays several biological activities in ribosome biogenesis, cell proliferation, cytoplasmic/nuclear shuttle transportation, nucleic acid binding, ribonucleic cleavage, and centrosome duplication. NSC 348884 is a putative inhibitor of nucleophosmin (NPM). NSC 348884 inhibits NMP oligomer formation, up-regulates p53 and induces apoptosis.
| Trivial name | NSC348884 50mg |
| Catalog Number | A13117-50 |
| Alternative Name(s) | N1,N1,N2,N2-Tetrakis[(6-methyl-1H-benzimidazol-2-yl)methyl]-1,2-ethanediamine |
| Molecular Formula | C38H40N10 |
| CAS# | 81624-55-7 |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)CN(CCN(CC3=NC4=C(N3)C=C(C=C4)C)CC5=NC6=C(N5)C=C(C=C6)C)CC7=NC8=C(N7)C=C(C=C8)C |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/nsc348884.html |
