(±)5-HETE lactone | MedChemExpress (MCE)
(±)5-HETE lactone is the racemate of 5-HETE lactone. 5-HETE lactone is a metabolite generated by a series of enzymatic reactions of arachidonic acid, and is also a substrate of paraoxonase-1 (PON1). 5-HETE lactone can be used in the study of B cell activation[1][2].
| Trivial name | (±)5-HETE lactone |
| Catalog Number | HY-130220 |
| Research Area | Inflammation/Immunology |
| CAS# | 81517-87-5 |
| Purity | ≥98.00% |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C=C\C1OC(CCC1)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/racemic-5-hete-lactone.html |