Alfuzosin Hydrochloride
API Standard
| Catalog Number | CS-O-00515 |
| Alternative Name(s) | N-(3-((4-Amino-6,7-dimethoxy-2-quinazolinyl)methylamino)propyl)tetrahydro-2-fural hydrchloride |
| Research Area | As an antagonist of the alpha-1 adrenergic receptor, it works by relaxing the muscles in the prostate and bladder neck, making it easier to urinate. It is thus used to treat benign prostatic hyperplasia (BPH). |
| Molecular Formula | C19H2ClN5O4 |
| CAS# | 81403-68-1 |
| Purity | >98% |
| SMILES | NC1=NC(N(C)CCCNC(C2CCCO2)=O)=NC3=C1C=C(OC)C(OC)=C3.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00515.html |
