Alfuzosin HCl 10mM * 1mL in DMSO
Alfuzosin (provided as the hydrochloride salt) is an ??1 receptor antagonist used to treat benign prostatic hyperplasia (BPH). It works by relaxing the muscles in the prostate and bladder neck, making it easier to urinate.
| Trivial name | Alfuzosin HCl 10mM * 1mL in DMSO |
| Catalog Number | A10052-10mM-D |
| Alternative Name(s) | N-[3-[(4-amino-6,7-dimethoxy-quinazolin-2-yl)- methyl-amino]propyl] tetrahydrofuran- 2-carboxamide hydrochloride |
| Molecular Formula | C19H27N5O4.HCl |
| CAS# | 81403-68-1 |
| SMILES | CN(CCCNC(=O)C1CCCO1)C2=NC3=CC(=C(C=C3C(=N2)N)OC)OC.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/alfuzosin-hcl.html |
