Apatinib 100mg
Apatinib (YN968D1) is a tyrosine kinase inhibitor that selectively inhibits the vascular endothelial growth factor receptor-2 (VEGFR2, also known as KDR) that inhibits VEGF-mediated endothelial cell migration and proliferation thus blocking new blood vessel formation in tumor tissue.
| Trivial name | Apatinib 100mg |
| Catalog Number | A11407-100 |
| Alternative Name(s) | N-[4-(1-cyanocyclopentyl) phenyl-2-(4-picolyl)amino-3-Nicotinamide methanesulphonate |
| Molecular Formula | C25H27N5O4S |
| CAS# | 811803-05-1 |
| SMILES | CS(=O)(=O)O.C1CCC(C1)(C#N)C2=CC=C(C=C2)NC(=O)C3=C(N=CC=C3)NCC4=CC=NC=C4 |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/apatinib-yn968d1.html |
