Rhodamine B
Rhodamine B is used as a tracer dye in water to determine the rate and direction of flow and transport. It is a staining fluorescent dye used in fluorescence microscopy, flow cytometry, fluorescence correlation spectroscopy and ELISA in biotechnology fields.
| Trivial name | N/A |
| Catalog Number | S5641 |
| Molecular Formula | C28H31ClN2O3 |
| CAS# | 81-88-9 |
| Inchi | InChI=1S/C28H30N2O3.ClH/c1-5-29(6-2)19-13-15-23-25(17-19)33-26-18-20(30(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(31)32;/h9-18H,5-8H2,1-4H3;1H |
| Inchi Key | PYWVYCXTNDRMGF-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=CC=CC=C4C(=O)O.[Cl-] |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/rhodamine-b.html |
| Additional Information | https://file.selleck.cn/downloads/struct/rhodamine-b-chemical-structure-s5641.gif |