Warfarin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-10379 |
| Alternative Name(s) | 4-Hydroxy-3-(3-oxo-1-phenyl-butyl)-2H-1-benzopyran-2-one;4-Hydroxy-3-(3-oxo-1-phenylbutyl)coumarin |
| Research Area | Coumarin anticoagulant. Marketed as the racemate; the S-(-)-form is the more potent isomer. Anticoagulant. |
| Molecular Formula | C19H16O4 |
| CAS# | 81-81-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(CC(C1=CC=CC=C1)C(C2=O)=C(C3=CC=CC=C3O2)O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10379.html |
| Additional Information | NULL |