Rifaximin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02226 |
| Alternative Name(s) | (7S,11S,12R,13S,14R,15R,16R,17S,18S,19Z,21Z)-2,15,17,36-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22,324,27,33-triazah,7.05,³5.0²6,³4.0²7,³²]heptatriaconta-1,3,5(35),9,19,21,25(36),26(34),28,30,32-undecaen-13-yl acetate |
| Research Area | Rifaximin is an orally administered, semi-synthetic, nonsystemic antibiotic derived from rifamycin SV with antibacterial activity. Rifaximin binds to the beta-subunit of bacterial DNA-dependent RNA polymerase, inhibiting bacterial RNA synthesis and bacter |
| Molecular Formula | C43H51N3O11 |
| CAS# | 80621-81-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C(C2=C3C(O)=C(NC(/C(C)=CC=C[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@H]4C)=O)C5=C2N=C6N5C=CC(C)=C6)=C(C(C)=C3O)O[C@@]1(O/C=C/[C@@H]([C@H]([C@H]4OC(C)=O)C)OC)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02226.html |
| Additional Information | NULL |