Grifolic Acid
Grifolic acid, a natural product isolated and purified from the Cylindrocarpon ianthothele var. majus, with anti-tumour and anti-haemolytic activities. Grifolic acid is a glucose-6-phosphatase inhibitor and a selective partial GPR120 agonist, can induce ERK and [Ca2+]i responses in cells expressing GPR120.
| Trivial name | / |
| Catalog Number | CSN14893 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C23H32O4 |
| CAS# | 80557-12-6 |
| Purity | ≥98% |
| SMILES | O=C(O)C1=C(C)C=C(O)C(C/C=C(C)/CC/C=C(C)/CC/C=C(C)\C)=C1O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/grifolic-acid.html |