Rac Threo-Dihydrobupropion Hydrochloride
rac threo-Dihydro Bupropion Hydrochloride a metabolite of the drug Bupropion (B689625), a selective inhibitor of dopamine uptake. An antidepressant of the aminoketone class; aid in smoking cessation.
| Catalog Number | CS-O-07444 |
| Alternative Name(s) | Threo- hydroxy Bupropion;Threo- hydroxy Bupropion;CHEMBL2111227; (1R,2R)-2-(tert-butylamino)-1-phenylpropan-1-ol; Threo- hydroxy Bupropion ;rac threo-2-(tert-Butylamino)-1-(3-chlorophenyl)propan-1-ol Hydrochloride;CS-BU-00110 |
| Research Area | Metabolites |
| Molecular Formula | C13H21Cl2NO |
| CAS# | 80478-42-8 |
| Purity | >98% |
| SMILES | O[C@@H](C1=CC(Cl)=CC=C1)[C@H](C)NC(C)(C)C.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07444.html |
