Fluticasone (propionate)
Fluticasone propionate (CCI-187881), derived from fluticasone used to remedy asthma and allergic rhinitis, is a high affinity, selective GR (glucocorticoid receptor) agonist.
| Catalog Number | T0188 |
| Alternative Name(s) | CCI-187881 , Fluticasone propionate |
| Research Area | Metabolism|||Microbiology/Virology|||Endocrinology/Hormones |
| Molecular Formula | C25H31F3O5S |
| CAS# | 80474-14-2 |
| Purity | 99.65% |
| SMILES | CCC(=O)O[C@@]1([C@H](C)C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]12C)C(=O)SCF |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/Fluticasone (propionate) |
| Additional Information | https://www.targetmol.com/datasheet/T0188 |
