(+) O Desmethyl Tramadol D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-08334 |
| Alternative Name(s) | [D6]-(+)-O-Desmethyltramadol hydrochloride; 3-[(1R,2R)-2-{[di(D3)methylamino]methyl}-1-hydroxycyclohexyl]phenol |
| Research Area | Labeled Tramadol, intended for use as an internal standard for the quantification of Tramadol by GC- or LC-mass spectrometry. |
| Molecular Formula | C15H17D6NO2 |
| CAS# | 80456-81-1(Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@](CCCC1)(C2=CC(O)=CC=C2)[C@H]1CN(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO08334.html |
| Additional Information | NULL |