Calcium Levofolinate
It is an intermediate product of the metabolism of Folic Acid; the active form into which that acid is converted in the body, ascorbic acid being a necessary factor in the conversion process.
| Catalog Number | CS-O-06299 |
| Alternative Name(s) | calcium (2S)-2-{[4-({[(6S)-2-amino-5-formyl-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)phenyl]formamido}pentanedioate |
| Research Area | Intermediates |
| Molecular Formula | C20H21CaN7O7 |
| CAS# | 80433-71-2 |
| Purity | >98% |
| SMILES | O=CN1C(C2=O)=C(NC(N)=N2)NC[C@@H]1CNC3=CC=C(C(N[C@H](C([O-])=O)CCC([O-])=O)=O)C=C3.[Ca+2] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06299.html |