2′,3,5,6′,7-Pentahydroxyflavanone
2′,3,5,6′,7-Pentahydroxyflavanone is a natural product isolated and purified from the roots of Scutellaria baicalensis Georgi which can inhibit the histamine release from rat mast cells induced by compound 48/80.
| Trivial name | / |
| Catalog Number | CSN13384 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C15H12O7 |
| CAS# | 80366-15-0 |
| Purity | ≥98% |
| SMILES | O=C1C(O)C(C2=C(O)C=CC=C2O)OC3=C1C(O)=CC(O)=C3 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/2',3,5,6',7-pentahydroxyflavanone.html |