Roxithromycin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30746 |
| Alternative Name(s) | (3R,4S,5S,6R,9R,10E,11S,12R,13S,14R)-6-{[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy}-14-ethyl-7,12,13-trihydroxy-4-{[(2R,4R,5S,6S)-5-hydroxy-4-hoxy-4,6- dimethyloxan-2-yl]oxy}-3,5,7,9,11,13-hexamethyl-10- (2,4,7-trioxa-1-azaocta |
| Research Area | Semisynthetic derivative of erythromycin and concentrated by human phagocytes and is bioactive intracellularly. While the drug is active against a wide spectrum of pathogens, it is effective in the treatment of respiratory and genital tract infections. |
| Molecular Formula | C41H76N2O15 |
| CAS# | 80214-83-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@H]([C@H]([C@](O)(C[C@H](/C1=NOCOCCOC)C)C)O[C@@](O[C@H](C)C[C@@H]2N(C)C)([H])[C@@H]2O)[C@]([C@H](C(O[C@@H]([C@@](O)([C@H](O)[C@H]1C)C)CC)=O)C)([H])O[C@@](O[C@@H](C)[C@@H]3O)([H])C[C@@]3(C)OC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30746.html |
| Additional Information | NULL |