Cefpodoxime D3 Acid
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06474 |
| Alternative Name(s) | (6R,7R)-7-[[(2Z)-2-(2-Amino-4-thiazolyl)-2-(methoxyimino-d3)acetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid; Cefpodoxime-d3; R 3763-d3; |
| Research Area | A labelled metabolite of Cefpodoxime Proxetil . An antibacterial.;Labeled Cefpodoxime, intended for use as an internal standard for the quantification of Cefpodoxime by GC- or LC-mass spectrometry. |
| Molecular Formula | C15H14D3N5O6S2 |
| CAS# | 80210-62-4 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(N1[C@@]2([H])[C@H](NC(/C(C3=CSC(N)=N3)=NOC([2H])([2H])[2H])=O)C1=O)=C(CS2)COC)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06474.html |
| Additional Information | NULL |