Lard oil | MedChemExpress (MCE)
Lard oil is a biochemical reagent that can be used as a biological material or organic compound for life science related research. Lard oil is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups.
Trivial name | Lard oil |
Catalog Number | HY-W127601 |
Research Area | Others |
CAS# | 8016-28-2 |
Purity | ≥98.00% |
SMILES | CC1=CN(C(NC1=O)=O)C2CC(N=[N+]=[N-])C(O2)COP(N3CCCCC3)(O)=O |
PubChem Chemical Structure ID | 44295191 |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/lard-oil.html |