Helicid
Helicid (Helicide) is a major constituent of Helicia nilgirica Bedd. Helicid has been used to treat psychoneurosis for its sedative-hypnotic and analgesic properties[1].
| Trivial name | Helicide; Helicidum; 4-Formylphenyl-β-D-allopyranoside |
| Catalog Number | CSN25432 |
| Alternative Name(s) | Helicide; Helicidum; 4-Formylphenyl-β-D-allopyranoside |
| Research Area | Neurological Disease|Infection |
| Molecular Formula | C13H16O7 |
| CAS# | 80154-34-3 |
| Purity | ≥99% |
| SMILES | O=CC1=CC=C(O[C@H]2[C@@H]([C@@H]([C@@H]([C@@H](CO)O2)O)O)O)C=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/helicid.html |