GSK256066 10mg
GSK256066 is an exceptionally high affinity and selective inhibitor of PDE4 that inhibits PDE4 isoforms A-D with equal affinity and has a high HARBS (High-Affinity Rolipram Binding Site) ratio (>17).
| Trivial name | GSK256066 10mg |
| Catalog Number | A11073-10 |
| Alternative Name(s) | 6-[[3-[(Dimethylamino)carbonyl]phenyl]sulfonyl]-4-[(3-methoxyphenyl)amino]-8-methyl-3-quinolinecarboxamide |
| Molecular Formula | C27H26N4O5S |
| CAS# | 801312-28-7 |
| SMILES | CC1=C2C(=CC(=C1)S(=O)(=O)C3=CC=CC(=C3)C(=O)N(C)C)C(=C(C=N2)C(=O)N)NC4=CC(=CC=C4)OC |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/gsk256066.html |
