Lathosterol (Standard) | MedChemExpress (MCE)
Lathosterol(Standard) is the analytical standard of Lathosterol. This product is intended for research and analytical applications. Lathosterol is a cholesterol-like molecule. Serum Lathosterol concentration is an indicator of whole-body cholesterol synthesis.
| Trivial name | Lathosterol (Standard) |
| Catalog Number | HY-113486R |
| Research Area | Metabolic Disease |
| CAS# | 80-99-9 |
| Purity | ≥98.0% |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@@]2([H])C3=CC[C@@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lathosterol-standard.html |