Felodipine EP Impurity C
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-59209 |
| Alternative Name(s) | Felodipine EP Impurity C;Nemadipine B;4-(2,34-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic Acid 3,5-Diethyl Ester;Nemadipine B |
| Research Area | A Diethyl ester analogue analogue of the calcium channel blocker Felodipine with antihypertensive activity. |
| Molecular Formula | C19H21Cl2NO4 |
| CAS# | 79925-38-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C(C(C=CC=C1Cl)=C1Cl)C(C(OCC)=O)=C(C)N2)=C2C)OCC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST59209.html |
| Additional Information | NULL |