Loratadine
Loratadine is a second generation antihistamine used to manage symptoms of allergic rhinitis. A lack of sedative and CNS adverse effects make loratadine, along with other second generation antihistamines, preferable over their 1st generation counterparts in many clinical situations.
| Catalog Number | API79794755 |
| Alternative Name(s) | Claritin Alavert Loratidine |
| Research Area | Antihistamine APIs |
| Molecular Formula | C22H23ClN2O2 |
| CAS# | 79794-75-5 |
| SMILES | CCOC(=O)N1CCC(=C2C3=C(CCC4=C2N=CC=C4)C=C(C=C3)Cl)CC1 |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/loratadine-item-6254.html |