MAO-IN-3 | MedChemExpress (MCE)
MAO-IN-3 (Compound 5) is a reversible and competitive MAO inhibitor (Ki: 0.6 and 0.2 μM for MAO A and MAO B). MAO-IN-3 inhibits LN-229 glioblastoma cell proliferation with an IC50 of 0.8 μM. MAO-IN-3 can be used for cancer research[1].
| Trivial name | MAO-IN-3 |
| Catalog Number | HY-149515 |
| Research Area | Cancer |
| CAS# | 797805-26-6 |
| Purity | ≥98.00% |
| SMILES | O=C(CCCCCNCC1=C(OC)C=CC=C1)NC2=CC=C(CCC3=CC=C(NC(CCCCCNCC4=C(OC)C=CC=C4)=O)C=C3)C=C2 |
| PubChem Chemical Structure ID | 11763838 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mao-in-3.html |