Levonorgestrel 1000mg
Levonorgestrelis a synthetic progesterone analog; binds to the progesterone receptor (relative binding affinities are < 0.02, 7.5, 17, 58 and 323 % for estrogen receptors, glucocorticoid receptors, mineralocorticoid receptors, androgen receptors and progesterone receptors respectively).
Trivial name | Levonorgestrel 1000mg |
Catalog Number | A10529-1000 |
Alternative Name(s) | N/A |
Molecular Formula | C₂₁H₂₈O₂ |
CAS# | 797-63-7 |
SMILES | CC[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C#C)O)CCC4=CC(=O)CC[C@H]34 |
Size | 1000mg |
Supplier Page | http://www.adooq.com/levonorgestrel.html |