LCH 7749944
LCH-7749944 is a novel and potent p21-activated kinase 4 (PAK4) inhibitor that suppresses proliferation and invasion in human gastric cancer cells through downregulation of PAK4/c-Src/EGFR/cyclin D1 pathway and causes successful inhibition of EGFR activity.
| Trivial name | GNF-PF-2356 |
| Catalog Number | CSN25301 |
| Alternative Name(s) | GNF-PF-2356 |
| Research Area | Cancer |
| Molecular Formula | C20H22N4O2 |
| CAS# | 796888-12-5 |
| Purity | ≥99% |
| SMILES | COC1=CC(NC2=NC(NCC3OCCC3)=C4C=CC=CC4=N2)=CC=C1 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/lch-7749944.html |