Lucidin-ω-Me ether | MedChemExpress (MCE)
Lucidin-ω-Me ether (Compound 2) can be isolated from the roots of Knoxia valerianoides. Lucidin-ω-Me ether inhibits the advanced glycation end products (AGEs) formation in vitro(IC50: 62.79 μM)[1].
| Trivial name | Lucidin-ω-Me ether |
| Catalog Number | HY-N12071 |
| Research Area | Others |
| CAS# | 79560-36-4 |
| Purity | ≥98.00% |
| SMILES | O=C1C2=C(C(C3=C(C(COC)=C(C=C13)O)O)=O)C=CC=C2 |
| PubChem Chemical Structure ID | 149782 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lucidin-ω-me-ether.html |