Azelastine HCl
Potent, second-generation, selective, histamine receptor antagonist Neuroscience|Histamine Receptor
| Catalog Number | B1568-5.1 |
| Research Area | Neuroscience|Histamine Receptor |
| Molecular Formula | C22H24ClN3O.HCl |
| CAS# | 79307-93-0 |
| Purity | 99.63% |
| SMILES | CN1CCCC(CC1)N2C(=O)C3=CC=CC=C3C(=N2)CC4=CC=C(C=C4)Cl.Cl |
| Size | 10mM (in 1mL DMSO) |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1568 |
