Apoptosis Activator 2 10mg
Apoptosis Activator 2 activates caspases in a cytochrome c-dependent manner and induces apoptosis in tumor cells by promoting the oligomerization of Apaf-1 into the mature apoptosome.
| Trivial name | Apoptosis Activator 2 10mg |
| Catalog Number | A11944-10 |
| Alternative Name(s) | 1-[(3,4-Dichlorophenyl)methyl]-1H-indole-2,3-dione |
| Molecular Formula | C15H9Cl2NO2 |
| CAS# | 79183-19-0 |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=O)N2CC3=CC(=C(C=C3)Cl)Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/apoptosis-activator-2.html |