17-β-Estradiol-16,16,17 D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10121 |
| Alternative Name(s) | Estradiol-d3;(17β)-Estra-1,3,5(10)-triene-3,17-diol-d3; 3,17-Epidihydroxyestratriene-d3 |
| Research Area | Potent mammalian estrogenic hormone produced by the ovary.;Labeled Estradiol, intended for use as an internal standard for the quantification of Estradiol by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H21D3O2 |
| CAS# | 79037-37-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1([C@@]2([2H])O)[C@](CC2([2H])[2H])([H])[C@@](CCC3=C4C=CC(O)=C3)([H])[C@]4([H])CC1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10121.html |
| Additional Information | NULL |