| Trivial name |
Terebic acid |
| Catalog Number |
EiM08-43127 |
| Alternative Name(s) |
Tetrahydro-2,2-dimethyl-5-oxo-3-furoic acid; 2,2-Dimethyl-5-oxooxolane-3-carboxylic acid; 2,2-Dimethyl-5-oxotetrahydrofuran-3-carboxylic acid |
| Research Area |
Drug Discovery Chemistry and Drug Screening |
| Molecular Formula |
C7H10O4 |
| CAS# |
79-91-4 |
| Purity |
95% |
| Inchi |
InChI=1S/C7H10O4/c1-7(2)4(6(9)10)3-5(8)11-7/h4H,3H2,1-2H3,(H,9,10) |
| Inchi Key |
UZBOWOQARWWIER-UHFFFAOYSA-N |
| SMILES |
CC1(C(CC(=O)O1)C(=O)O)C |
| PubChem Chemical Structure ID |
101540 |
| Size |
from 1 microMole to 1 g |
| Supplier Page |
http://eximedlab.com/libraries.html |
