Levopimaric Acid
Fine Chemicals
| Trivial name | NULL |
| Catalog Number | CS-T-31036 |
| Alternative Name(s) | 1R,4aR,4bS,10aR)- 1,2,3,4,4a,4b,5,9,10,10aethyl)-1-phenanthrenecarboxylic Acid;(1R,4aR,4bS,10aR)- 1,2,3,4,4a,4b,5,9,10,10aethyl)-1-phenanthrenecarboxylic Acid;(1R,4aR,4bS,10aR)-7-isopropyl-1,4a-dimethyl-1,2,3,4,4a,4b,5,9,10,10a-decahydrophenanthrene-1-car |
| Research Area | Levopimaric Acid is a major component of pine oleoresin. It is an abietane-type of diterpene resin acid and has antibacterial, cardiovascular, and antioxidant properties. |
| Molecular Formula | C20H30O2 |
| CAS# | 79-54-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@]([C@]1([H])C2=CC(C(C)C)=CC1)(CCC3)[C@](CC2)([H])[C@]3(C)C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST31036.html |
| Additional Information | NULL |