Amorfrutin B | MedChemExpress (MCE)
Amorfrutin B is a highly potent natural peroxisome proliferation-activated receptor γ (PPARγ) agonist with oral activity with Ki values of 19 nM and EC50 values of 73 nM, respectively. Amorfrutin B has hypoglycemic and neuroprotective activities[1][2].
| Trivial name | Amorfrutin B |
| Catalog Number | HY-113631 |
| Research Area | Neurological Disease; Metabolic Disease |
| CAS# | 78916-42-4 |
| Purity | ≥98.0% |
| SMILES | O=C(O)C1=C(CCC2=CC=CC=C2)C=C(OC)C(C/C=C(C)/CC/C=C(C)\C)=C1O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/amorfrutin-b.html |