MAO-B-IN-27 | MedChemExpress (MCE)
MAO-B-IN-27 (Compound 12c) is a monoamine oxidase B (MAO-B) inhibitor. MAO-B-IN-27 has potent and selective MAO-B inhibitory effect for hMAO-B with an IC50 values of 8.9 nM. MAO-B-IN-27 can be used for the research of parkinson’s disease (PD)[1].
| Trivial name | MAO-B-IN-27 |
| Catalog Number | HY-160002 |
| Research Area | Neurological Disease |
| CAS# | 788824-83-9 |
| Purity | ≥98.00% |
| SMILES | FC(F)(C1=CC=C(COC2=CC=C(CCN)C=C2)C=C1)F.Cl |
| PubChem Chemical Structure ID | 11580776 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mao-b-in-27.html |