Calcitriol D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06457 |
| Alternative Name(s) | (1R,3S,5Z)-5-{2-[(1R,3aS,4E,7aR)-1-[(2R)-6-hydroxy-6- (D3)methyl(7,7,7-2H3)heptan-2-yl]-7a-methyl- octahydro-1H-inden-4-ylidene]ethylidene}-4- methylidenecyclohexane-1,3-diol |
| Research Area | Labeled Calcitriol, intended for use as an internal standard for the quantification of Calcitriol by GC- or LC-mass spectrometry. |
| Molecular Formula | C27H38D6O3 |
| CAS# | 78782-99-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@]([C@@]1([H])[C@H](C)CCCC(C([2H])([2H])[2H])(O)C([2H])([2H])[2H])(CCC/2)[C@](CC1)([H])C2=CC=C(C[C@@H](O)C[C@@H]3O)/C3=C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06457.html |
| Additional Information | NULL |