Terbinafine hydrochloride 10mM * 1mL in DMSO
Terbinafine HCl a member of the allylamine class of antifungals, has been found to be a specific inhibitor of ergosterol synthesis via squalene epoxidase inhibition.
| Trivial name | Terbinafine hydrochloride 10mM * 1mL in DMSO |
| Catalog Number | A10912-10mM-D |
| Alternative Name(s) | (E)-N-(6,6-Dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthalenemethanamine monohydrochloride |
| Molecular Formula | C21H26ClN |
| CAS# | 78628-80-5 |
| SMILES | CC(C)(C)C#C/C=C/CN(C)CC1=CC=CC2=CC=CC=C21.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/terbinafine-hydrochloride-lamisil.html |
