Milrinone (Primacor) 10mM * 1mL in DMSO
Milrinone(Primacor) is a a potent and selective phosphodiesterase 3 inhibitor with an IC50 of 0.42 ??M for the inhibition of FIII PDE
| Trivial name | Milrinone (Primacor) 10mM * 1mL in DMSO |
| Catalog Number | A10592-10mM-D |
| Alternative Name(s) | 1,6-Dihydro-2-methyl-6-oxo-(3,4'-bipyridine)-5-carbonitrile |
| Molecular Formula | C12H9N3O |
| CAS# | 78415-72-2 |
| SMILES | CC1=C(C=C(C(=O)N1)C#N)C2=CC=NC=C2 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/milrinone-primacor.html |
