Nepafenac
Nepafenac is a selective COX2 inhibitor and is prodrug of amfenac used in the treatment of pain and inflammation associated with cataract surgery.
| Trivial name | AHR 9434; AL-6515 |
| Catalog Number | CSN11540 |
| Alternative Name(s) | AHR 9434; AL-6515 |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C15H14N2O2 |
| CAS# | 78281-72-8 |
| Purity | ≥99% |
| SMILES | O=C(N)CC1=CC=CC(C(C2=CC=CC=C2)=O)=C1N |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/nepafenac.html |
