YM155 10mM * 1mL in DMSO
YM155 is a novel small molecule survivin suppressant with an IC50 of 0.54 nM for the inhibition of survivin promoter activity.
| Trivial name | YM155 10mM * 1mL in DMSO |
| Catalog Number | A11002-10mM-D |
| Alternative Name(s) | 4,9-Dihydro-1-(2-methoxyethyl)-2-methyl-4,9-dioxo-3-(2-pyrazinylmethyl)-1H-naphth[2,3-d]imidazolium bromide |
| Molecular Formula | C20H19BrN4O3 |
| CAS# | 781661-94-7 |
| SMILES | CC1=[N+](C2=C(N1CCOC)C(=O)C3=CC=CC=C3C2=O)CC4=NC=CN=C4.[Br-] |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ym155.html |
