Aztreonam 10mM * 1mL in DMSO
Aztreonam is a synthetic monocyclic beta-lactam antibiotic (a monobactam), with the nucleus based on a simpler monobactam isolated from Chromobacterium violaceum.
| Trivial name | Aztreonam 10mM * 1mL in DMSO |
| Catalog Number | A10118-10mM-D |
| Alternative Name(s) | 2-({[(1Z)-1-(2-amino-1,3-thiazol-4-yl) -2- {[(2S,3S)-2-methyl-4-oxo-1-sulfoazetidin-3-yl]amino} -2- oxoethylidene]amino}oxy)-2-methylpropanoic acid |
| Molecular Formula | C13H17N5O8S2 |
| CAS# | 78110-38-0 |
| SMILES | C[C@H]1[C@@H](C(=O)N1S(=O)(=O)O)NC(=O)/C(=NOC(C)(C)C(=O)O)/C2=CSC(=N2)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/aztreonam-azactam-cayston.html |