Doxazosin mesylate 10mM * 1mL in DMSO
Doxazosin mesylate, a quinazoline compound, is an ??1-selective alpha blocker used to treat high blood pressure and urinary retention associated with benign prostatic hyperplasia (BPH).
| Trivial name | Doxazosin mesylate 10mM * 1mL in DMSO |
| Catalog Number | A10334-10mM-D |
| Alternative Name(s) | 1-(4-Amino-6,7-dimethoxy-2-quinazolinyl)-4-(1,4-benzodioxan-2-ylcarbonyl) piperazine methanesulfonate |
| Molecular Formula | C23H25N5O5.CH3SO3H;C24H29N5O8S |
| CAS# | 77883-43-3 |
| SMILES | COC1=C(C=C2C(=C1)C(=NC(=N2)N3CCN(CC3)C(=O)C4COC5=CC=CC=C5O4)N)OC.CS(=O)(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/doxazosin-mesylate.html |