(±)-Enterodiol | MedChemExpress (MCE)
(±)-Enterodiol is the racemate of Enterodiol (HY-108695). Enterodiol is transformed by human intestinal bacteria from lignans contained in various whole-grain cereals, nuts, legumes, flaxseed, and vegetables. Enterodiol has an apoptotic effect in colorectal cancer (CRC) cells. Enterodiol has anti-cancer activities[1][2].
| Trivial name | (±)-Enterodiol |
| Catalog Number | HY-108695B |
| Research Area | Cancer |
| CAS# | 77756-22-0 |
| Purity | ≥98.0% |
| SMILES | OC1=CC=CC(C[C@@H](CO)[C@H](CO)CC2=CC(O)=CC=C2)=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/racemic-enterodiol.html |