DMHAPC-Chol | MedChemExpress (MCE)
DMHAPC-Chol, a cationic lipid, contains a biodegradable carbamoyl linker and a hydroxyethyl group in the polar amino head moiety. DMHAPC-Chol can be used in both transfection experiments concerning plasmids or siRNA[1].
| Trivial name | DMHAPC-Chol |
| Catalog Number | HY-125734 |
| Research Area | Others |
| CAS# | 774598-29-7 |
| Purity | ≥98.0% |
| SMILES | C[C@@H]([C@]1(CC[C@]2([C@@]3(CC=C4C[C@H](CC[C@@]4([C@]3(CC[C@@]21C)[H])C)OC(NCCC[N+](C)(CCO)C)=O)[H])[H])[H])CCCC(C)C.[I-] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/dmhapc-chol.html |